C17H28IN5O2 — CID 111873406
4-[[[ethylamino-[[2-(ethylamino)-2-oxoethyl]amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111873406) has the molecular formula C17H28IN5O2 and a molecular weight of 461.35 g/mol. Its IUPAC name is 4-[[[ethylamino-[[2-(ethylamino)-2-oxoethyl]amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[[2-(ethylamino)-2-oxoethyl]amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111873406 |
| Molecular Formula | C17H28IN5O2 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 4-[[[ethylamino-[[2-(ethylamino)-2-oxoethyl]amino]methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCNC(=O)CN/C(=N/Cc1ccc(C(=O)N(C)C)cc1)NCC.I |
| InChI | InChI=1S/C17H27N5O2.HI/c1-5-18-15(23)12-21-17(19-6-2)20-11-13-7-9-14(10-8-13)16(24)22(3)4;/h7-10H,5-6,11-12H2,1-4H3,(H,18,23)(H2,19,20,21);1H |
| InChIKey | DNPJJALCQHMJQR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|