C20H25BrN4O — CID 111875741
4-[[[[(4-bromophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111875741) has the molecular formula C20H25BrN4O and a molecular weight of 417.35 g/mol. Its IUPAC name is 4-[[[[(4-bromophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[[(4-bromophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111875741 |
| Molecular Formula | C20H25BrN4O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-[[[[(4-bromophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H25BrN4O/c1-4-22-20(24-14-16-7-11-18(21)12-8-16)23-13-15-5-9-17(10-6-15)19(26)25(2)3/h5-12H,4,13-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | MPGYJMMGIQZAIA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|