C12H19BrIN3 — CID 86777408
2-[(4-bromophenyl)methyl]-1,3-diethylguanidine;hydroiodide (PubChem CID 86777408) has the molecular formula C12H19BrIN3 and a molecular weight of 412.11 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1,3-diethylguanidine;hydroiodide.
| Compound Name | 2-[(4-bromophenyl)methyl]-1,3-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 86777408 |
| Molecular Formula | C12H19BrIN3 |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1,3-diethylguanidine;hydroiodide |
| SMILES | CCNC(=NCc1ccc(Br)cc1)NCC.I |
| InChI | InChI=1S/C12H18BrN3.HI/c1-3-14-12(15-4-2)16-9-10-5-7-11(13)8-6-10;/h5-8H,3-4,9H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | TXIMZFFLLINZII-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|