C16H22BrIN4S — CID 111977643
2-[(4-bromophenyl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111977643) has the molecular formula C16H22BrIN4S and a molecular weight of 509.26 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111977643 |
| Molecular Formula | C16H22BrIN4S |
| Molecular Weight | 509.26 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1)NCc1nc(C)c(C)s1.I |
| InChI | InChI=1S/C16H21BrN4S.HI/c1-4-18-16(19-9-13-5-7-14(17)8-6-13)20-10-15-21-11(2)12(3)22-15;/h5-8H,4,9-10H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | NEDPEVPSRRSMDD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|