C14H19ClN4S2 — CID 119163143
2-[(5-chlorothiophen-2-yl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 119163143) has the molecular formula C14H19ClN4S2 and a molecular weight of 342.92 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 119163143 |
| Molecular Formula | C14H19ClN4S2 |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl]-1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)s1)NCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H19ClN4S2/c1-4-16-14(17-7-11-5-6-12(15)21-11)18-8-13-19-9(2)10(3)20-13/h5-6H,4,7-8H2,1-3H3,(H2,16,17,18) |
| InChIKey | PWJLCFUCHNJVIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|