C17H23ClN4OS — CID 111986733
1-[2-(2-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 111986733) has the molecular formula C17H23ClN4OS and a molecular weight of 366.92 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111986733 |
| Molecular Formula | C17H23ClN4OS |
| Molecular Weight | 366.92 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-2-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)s1)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN4OS/c1-4-19-17(21-10-16-22-11(2)12(3)24-16)20-9-15(23)13-7-5-6-8-14(13)18/h5-8,15,23H,4,9-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | NPOGCWPSNOMXOE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|