C21H27ClN4O2 — CID 111998623
4-[[[[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111998623) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 4-[[[[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111998623 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[[[[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C21H27ClN4O2/c1-4-23-21(25-14-19(27)17-7-5-6-8-18(17)22)24-13-15-9-11-16(12-10-15)20(28)26(2)3/h5-12,19,27H,4,13-14H2,1-3H3,(H2,23,24,25) |
| InChIKey | UINXZKVHYWOPBV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|