C28H34N4O — CID 111233753
4-[[[(3,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111233753) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 4-[[[(3,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[(3,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111233753 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 4-[[[(3,3-diphenylpropylamino)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34N4O/c1-4-29-28(31-21-22-15-17-25(18-16-22)27(33)32(2)3)30-20-19-26(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,26H,4,19-21H2,1-3H3,(H2,29,30,31) |
| InChIKey | PYIDWBQDPKPNAA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|