C24H36IN5O — CID 111875088
4-[[[[3-[benzyl(methyl)amino]propylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111875088) has the molecular formula C24H36IN5O and a molecular weight of 537.49 g/mol. Its IUPAC name is 4-[[[[3-[benzyl(methyl)amino]propylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[[3-[benzyl(methyl)amino]propylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111875088 |
| Molecular Formula | C24H36IN5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 4-[[[[3-[benzyl(methyl)amino]propylamino]-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCCCN(C)Cc1ccccc1.I |
| InChI | InChI=1S/C24H35N5O.HI/c1-5-25-24(26-16-9-17-29(4)19-21-10-7-6-8-11-21)27-18-20-12-14-22(15-13-20)23(30)28(2)3;/h6-8,10-15H,5,9,16-19H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | ZFRPXFLJMNUQBK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|