C17H23Cl2IN6O — CID 111953568
3,4-dichloro-N-[2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111953568) has the molecular formula C17H23Cl2IN6O and a molecular weight of 525.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111953568 |
| Molecular Formula | C17H23Cl2IN6O |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[(2-methylpyrazol-3-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCNC(=O)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C17H22Cl2N6O.HI/c1-3-20-17(23-11-13-6-7-24-25(13)2)22-9-8-21-16(26)12-4-5-14(18)15(19)10-12;/h4-7,10H,3,8-9,11H2,1-2H3,(H,21,26)(H2,20,22,23);1H |
| InChIKey | BYRWNOVNWCFQIB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|