C19H25Cl2N5O2 — CID 111587469
3,4-dichloro-N-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111587469) has the molecular formula C19H25Cl2N5O2 and a molecular weight of 426.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111587469 |
| Molecular Formula | C19H25Cl2N5O2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H25Cl2N5O2/c1-4-22-19(25-11-14-10-17(12(2)3)26-28-14)24-8-7-23-18(27)13-5-6-15(20)16(21)9-13/h5-6,9-10,12H,4,7-8,11H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | FJWXOCNKTMUGGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|