C16H29IN4O3 — CID 111587156
methyl 5-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111587156) has the molecular formula C16H29IN4O3 and a molecular weight of 452.34 g/mol. Its IUPAC name is methyl 5-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111587156 |
| Molecular Formula | C16H29IN4O3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | methyl 5-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCCCC(=O)OC.I |
| InChI | InChI=1S/C16H28N4O3.HI/c1-5-17-16(18-9-7-6-8-15(21)22-4)19-11-13-10-14(12(2)3)20-23-13;/h10,12H,5-9,11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | PRIWMTCNQKNVQF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|