C18H35IN4O2 — CID 111674831
1-ethyl-3-(5-methoxypentyl)-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111674831) has the molecular formula C18H35IN4O2 and a molecular weight of 466.41 g/mol. Its IUPAC name is 1-ethyl-3-(5-methoxypentyl)-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(5-methoxypentyl)-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111674831 |
| Molecular Formula | C18H35IN4O2 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-ethyl-3-(5-methoxypentyl)-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCCCCOC.I |
| InChI | InChI=1S/C18H34N4O2.HI/c1-5-15(6-2)17-13-16(24-22-17)14-21-18(19-7-3)20-11-9-8-10-12-23-4;/h13,15H,5-12,14H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | STJBOJCLDQFRRW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|