C20H34N6O — CID 111514120
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111514120) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111514120 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C20H34N6O/c1-6-17(7-2)19-13-18(27-25-19)14-23-20(21-8-3)22-10-9-11-26-16(5)12-15(4)24-26/h12-13,17H,6-11,14H2,1-5H3,(H2,21,22,23) |
| InChIKey | RATZKALSPXIUKQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|