C18H31IN6O — CID 111676301
1-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111676301) has the molecular formula C18H31IN6O and a molecular weight of 474.39 g/mol. Its IUPAC name is 1-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111676301 |
| Molecular Formula | C18H31IN6O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-ethyl-2-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCCn1cccn1.I |
| InChI | InChI=1S/C18H30N6O.HI/c1-4-15(5-2)17-13-16(25-23-17)14-21-18(19-6-3)20-9-7-11-24-12-8-10-22-24;/h8,10,12-13,15H,4-7,9,11,14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | CXRISBGTGFLKMF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|