C20H37N5O3 — CID 111676304
tert-butyl N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111676304) has the molecular formula C20H37N5O3 and a molecular weight of 395.55 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111676304 |
| Molecular Formula | C20H37N5O3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N5O3/c1-7-15(8-2)17-13-16(28-25-17)14-24-18(21-9-3)22-11-10-12-23-19(26)27-20(4,5)6/h13,15H,7-12,14H2,1-6H3,(H,23,26)(H2,21,22,24) |
| InChIKey | UKUCMSLQVATLBQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|