C17H31N5O2 — CID 111675590
3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]-2,2-dimethylpropanamide (PubChem CID 111675590) has the molecular formula C17H31N5O2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111675590 |
| Molecular Formula | C17H31N5O2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C17H31N5O2/c1-6-12(7-2)14-9-13(24-22-14)10-20-16(19-8-3)21-11-17(4,5)15(18)23/h9,12H,6-8,10-11H2,1-5H3,(H2,18,23)(H2,19,20,21) |
| InChIKey | UEZNPNDPXUKAAU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|