C19H30IN5O3 — CID 111675835
N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111675835) has the molecular formula C19H30IN5O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111675835 |
| Molecular Formula | C19H30IN5O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C19H29N5O3.HI/c1-4-14(5-2)16-12-15(27-24-16)13-23-19(20-6-3)22-10-9-21-18(25)17-8-7-11-26-17;/h7-8,11-12,14H,4-6,9-10,13H2,1-3H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | VWLJXZVNLQRSFU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|