C18H24FIN4O2 — CID 111395330
N-[2-[[N-ethyl-N'-[2-(3-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111395330) has the molecular formula C18H24FIN4O2 and a molecular weight of 474.32 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(3-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(3-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111395330 |
| Molecular Formula | C18H24FIN4O2 |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(3-fluorophenyl)ethyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc(F)c1)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C18H23FN4O2.HI/c1-2-20-18(22-9-8-14-5-3-6-15(19)13-14)23-11-10-21-17(24)16-7-4-12-25-16;/h3-7,12-13H,2,8-11H2,1H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | JKQCIWGXYSZVMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|