C20H29IN4O4 — CID 111214314
N-[2-[[N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111214314) has the molecular formula C20H29IN4O4 and a molecular weight of 516.38 g/mol. Its IUPAC name is N-[2-[[N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111214314 |
| Molecular Formula | C20H29IN4O4 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[2-[[N'-[2-(3,4-dimethoxyphenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C20H28N4O4.HI/c1-4-21-20(24-12-11-22-19(25)17-6-5-13-28-17)23-10-9-15-7-8-16(26-2)18(14-15)27-3;/h5-8,13-14H,4,9-12H2,1-3H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | GUVDTWXJZKCMSH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|