C20H31N5O2S — CID 111674796
N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111674796) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111674796 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C20H31N5O2S/c1-4-15(5-2)17-13-16(27-25-17)14-24-20(21-6-3)23-11-8-10-22-19(26)18-9-7-12-28-18/h7,9,12-13,15H,4-6,8,10-11,14H2,1-3H3,(H,22,26)(H2,21,23,24) |
| InChIKey | XVUDFZMRRQFMOQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|