C21H31ClIN5O2 — CID 111675293
4-chloro-N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111675293) has the molecular formula C21H31ClIN5O2 and a molecular weight of 547.87 g/mol. Its IUPAC name is 4-chloro-N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-chloro-N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111675293 |
| Molecular Formula | C21H31ClIN5O2 |
| Molecular Weight | 547.87 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 4-chloro-N-[2-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCCNC(=O)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C21H30ClN5O2.HI/c1-4-15(5-2)19-13-18(29-27-19)14-26-21(23-6-3)25-12-11-24-20(28)16-7-9-17(22)10-8-16;/h7-10,13,15H,4-6,11-12,14H2,1-3H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | KXXMGNABKFXUPK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|