C22H32FN5O2 — CID 111674844
2-[[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111674844) has the molecular formula C22H32FN5O2 and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111674844 |
| Molecular Formula | C22H32FN5O2 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-[[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C22H32FN5O2/c1-4-16(5-2)20-12-19(30-28-20)14-27-22(25-6-3)26-13-17(21(24)29)11-15-7-9-18(23)10-8-15/h7-10,12,16-17H,4-6,11,13-14H2,1-3H3,(H2,24,29)(H2,25,26,27) |
| InChIKey | TVDUNBPLEWYIAK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|