C15H28N6O3 — CID 111886649
tert-butyl N-[3-[[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886649) has the molecular formula C15H28N6O3 and a molecular weight of 340.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886649 |
| Molecular Formula | C15H28N6O3 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1nc(C)no1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N6O3/c1-6-16-13(19-10-12-20-11(2)21-24-12)17-8-7-9-18-14(22)23-15(3,4)5/h6-10H2,1-5H3,(H,18,22)(H2,16,17,19) |
| InChIKey | UOPWPERULXBHAZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|