C17H30N4O2S — CID 111885899
tert-butyl N-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111885899) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111885899 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O2S/c1-6-18-15(21-12-14-9-8-13(2)24-14)19-10-7-11-20-16(22)23-17(3,4)5/h8-9H,6-7,10-12H2,1-5H3,(H,20,22)(H2,18,19,21) |
| InChIKey | CCBVFHHWGCDMSA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|