C16H28BrIN4O2S — CID 111886674
tert-butyl N-[3-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886674) has the molecular formula C16H28BrIN4O2S and a molecular weight of 547.30 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886674 |
| Molecular Formula | C16H28BrIN4O2S |
| Molecular Weight | 547.30 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | tert-butyl N-[3-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H27BrN4O2S.HI/c1-5-18-14(21-10-13-9-12(17)11-24-13)19-7-6-8-20-15(22)23-16(2,3)4;/h9,11H,5-8,10H2,1-4H3,(H,20,22)(H2,18,19,21);1H |
| InChIKey | PWUHDOBGKWUSPP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|