C14H22BrIN4OS — CID 111926993
N-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111926993) has the molecular formula C14H22BrIN4OS and a molecular weight of 501.23 g/mol. Its IUPAC name is N-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111926993 |
| Molecular Formula | C14H22BrIN4OS |
| Molecular Weight | 501.23 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | N-[2-[[N'-[(4-bromothiophen-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)cs1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C14H21BrN4OS.HI/c1-2-16-14(19-8-12-7-11(15)9-21-12)18-6-5-17-13(20)10-3-4-10;/h7,9-10H,2-6,8H2,1H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | AOYSVTFWXGRMGQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|