C15H23BrN4OS — CID 111863265
N-[2-[[N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111863265) has the molecular formula C15H23BrN4OS and a molecular weight of 387.35 g/mol. Its IUPAC name is N-[2-[[N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111863265 |
| Molecular Formula | C15H23BrN4OS |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[2-[[N'-[2-(5-bromothiophen-2-yl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CCc1ccc(Br)s1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C15H23BrN4OS/c1-2-17-15(19-8-7-12-5-6-13(16)22-12)20-10-9-18-14(21)11-3-4-11/h5-6,11H,2-4,7-10H2,1H3,(H,18,21)(H2,17,19,20) |
| InChIKey | NKYMSZOZXFQNAH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|