C13H22BrN3OS — CID 110973863
1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine (PubChem CID 110973863) has the molecular formula C13H22BrN3OS and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 110973863 |
| Molecular Formula | C13H22BrN3OS |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOC)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H22BrN3OS/c1-3-15-13(16-8-4-10-18-2)17-9-7-11-5-6-12(14)19-11/h5-6H,3-4,7-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | YFIREERCVCOVJZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|