C14H25BrIN3OS — CID 111607156
1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-methoxy-2-methylpropyl)guanidine;hydroiodide (PubChem CID 111607156) has the molecular formula C14H25BrIN3OS and a molecular weight of 490.25 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-methoxy-2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-methoxy-2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111607156 |
| Molecular Formula | C14H25BrIN3OS |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-ethyl-2-(2-methoxy-2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCCc1ccc(Br)s1.I |
| InChI | InChI=1S/C14H24BrN3OS.HI/c1-5-16-13(18-10-14(2,3)19-4)17-9-8-11-6-7-12(15)20-11;/h6-7H,5,8-10H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | CAMLXMIQKITTLS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|