C15H25BrN4OS — CID 111384311
2-[[[2-(5-bromothiophen-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N-tert-butylacetamide (PubChem CID 111384311) has the molecular formula C15H25BrN4OS and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-[[[2-(5-bromothiophen-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[[2-(5-bromothiophen-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111384311 |
| Molecular Formula | C15H25BrN4OS |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-[[[2-(5-bromothiophen-2-yl)ethylamino]-(ethylamino)methylidene]amino]-N-tert-butylacetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C15H25BrN4OS/c1-5-17-14(19-10-13(21)20-15(2,3)4)18-9-8-11-6-7-12(16)22-11/h6-7H,5,8-10H2,1-4H3,(H,20,21)(H2,17,18,19) |
| InChIKey | MXRSRKZKSSVPMJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|