C19H35N5O3S2 — CID 111384419
N-tert-butyl-2-[[[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethylamino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111384419) has the molecular formula C19H35N5O3S2 and a molecular weight of 445.66 g/mol. Its IUPAC name is N-tert-butyl-2-[[[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethylamino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethylamino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111384419 |
| Molecular Formula | C19H35N5O3S2 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-tert-butyl-2-[[[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethylamino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1ccc(S(=O)(=O)N(CC)CC)s1 |
| InChI | InChI=1S/C19H35N5O3S2/c1-7-20-18(22-14-16(25)23-19(4,5)6)21-13-12-15-10-11-17(28-15)29(26,27)24(8-2)9-3/h10-11H,7-9,12-14H2,1-6H3,(H,23,25)(H2,20,21,22) |
| InChIKey | VCXKSWDAEHWWSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|