C16H31IN4O2S2 — CID 111150137
1-butyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111150137) has the molecular formula C16H31IN4O2S2 and a molecular weight of 502.49 g/mol. Its IUPAC name is 1-butyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111150137 |
| Molecular Formula | C16H31IN4O2S2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-butyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCCCN/C(=N\C)NCCc1ccc(S(=O)(=O)N(CC)CC)s1.I |
| InChI | InChI=1S/C16H30N4O2S2.HI/c1-5-8-12-18-16(17-4)19-13-11-14-9-10-15(23-14)24(21,22)20(6-2)7-3;/h9-10H,5-8,11-13H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | CMSHRDWMAHZKBV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|