C20H31IN4O2S2 — CID 110951743
1-benzyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 110951743) has the molecular formula C20H31IN4O2S2 and a molecular weight of 550.53 g/mol. Its IUPAC name is 1-benzyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110951743 |
| Molecular Formula | C20H31IN4O2S2 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 1-benzyl-3-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCN/C(=N\C)N(C)Cc2ccccc2)s1.I |
| InChI | InChI=1S/C20H30N4O2S2.HI/c1-5-24(6-2)28(25,26)19-13-12-18(27-19)14-15-22-20(21-3)23(4)16-17-10-8-7-9-11-17;/h7-13H,5-6,14-16H2,1-4H3,(H,21,22);1H |
| InChIKey | JEYMLXNXXQRCOM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|