C18H35IN4O4S2 — CID 111405286
1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111405286) has the molecular formula C18H35IN4O4S2 and a molecular weight of 562.54 g/mol. Its IUPAC name is 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111405286 |
| Molecular Formula | C18H35IN4O4S2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCN/C(=N/C)NCCCOCCOC)s1.I |
| InChI | InChI=1S/C18H34N4O4S2.HI/c1-5-22(6-2)28(23,24)17-9-8-16(27-17)10-12-21-18(19-3)20-11-7-13-26-15-14-25-4;/h8-9H,5-7,10-15H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | SPGTYCDVLBTHTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|