C20H39IN4O3S2 — CID 111710196
1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide (PubChem CID 111710196) has the molecular formula C20H39IN4O3S2 and a molecular weight of 574.60 g/mol. Its IUPAC name is 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111710196 |
| Molecular Formula | C20H39IN4O3S2 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)NCCc1ccc(S(=O)(=O)N(CC)CC)s1.I |
| InChI | InChI=1S/C20H38N4O3S2.HI/c1-8-21-19(23-15-17(27-7)20(4,5)6)22-14-13-16-11-12-18(28-16)29(25,26)24(9-2)10-3;/h11-12,17H,8-10,13-15H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | TZVIDUGXESHZLY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|