C18H30IN5O2S3 — CID 111524833
1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111524833) has the molecular formula C18H30IN5O2S3 and a molecular weight of 571.58 g/mol. Its IUPAC name is 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524833 |
| Molecular Formula | C18H30IN5O2S3 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-3-ethyl-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCCc1ccc(S(=O)(=O)N(CC)CC)s1.I |
| InChI | InChI=1S/C18H29N5O2S3.HI/c1-5-19-18(22-13-16-21-12-14(4)26-16)20-11-10-15-8-9-17(27-15)28(24,25)23(6-2)7-3;/h8-9,12H,5-7,10-11,13H2,1-4H3,(H2,19,20,22);1H |
| InChIKey | IPBPNQBCRKLCEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|