C20H38IN5O2S2 — CID 111019504
1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111019504) has the molecular formula C20H38IN5O2S2 and a molecular weight of 571.60 g/mol. Its IUPAC name is 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111019504 |
| Molecular Formula | C20H38IN5O2S2 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 1-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-2-methyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCCc2ccc(S(=O)(=O)N(CC)CC)s2)CC1.I |
| InChI | InChI=1S/C20H37N5O2S2.HI/c1-5-14-24-15-11-17(12-16-24)23-20(21-4)22-13-10-18-8-9-19(28-18)29(26,27)25(6-2)7-3;/h8-9,17H,5-7,10-16H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | JWWKIWUXODYSRE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|