C18H32N4O2S2 — CID 111211375
N-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N',4-dimethylpiperidine-1-carboximidamide (PubChem CID 111211375) has the molecular formula C18H32N4O2S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is N-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N',4-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N',4-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111211375 |
| Molecular Formula | C18H32N4O2S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N',4-dimethylpiperidine-1-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCN/C(=N\C)N2CCC(C)CC2)s1 |
| InChI | InChI=1S/C18H32N4O2S2/c1-5-22(6-2)26(23,24)17-8-7-16(25-17)9-12-20-18(19-4)21-13-10-15(3)11-14-21/h7-8,15H,5-6,9-14H2,1-4H3,(H,19,20) |
| InChIKey | OJPVAUNPTKTLFG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|