C19H33N5O3S2 — CID 110963755
4-acetyl-N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110963755) has the molecular formula C19H33N5O3S2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 4-acetyl-N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963755 |
| Molecular Formula | C19H33N5O3S2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-acetyl-N'-[2-[5-(diethylsulfamoyl)thiophen-2-yl]ethyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(S(=O)(=O)N(CC)CC)s1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H33N5O3S2/c1-5-20-19(23-14-12-22(13-15-23)16(4)25)21-11-10-17-8-9-18(28-17)29(26,27)24(6-2)7-3/h8-9H,5-7,10-15H2,1-4H3,(H,20,21) |
| InChIKey | RZBKAOQMLXPEEP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|