C19H27N5OS2 — CID 110963811
4-acetyl-N-ethyl-N'-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]piperazine-1-carboximidamide (PubChem CID 110963811) has the molecular formula C19H27N5OS2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-ethyl-N'-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963811 |
| Molecular Formula | C19H27N5OS2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1ccc(-c2csc(C)n2)s1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H27N5OS2/c1-4-20-19(24-11-9-23(10-12-24)15(3)25)21-8-7-16-5-6-18(27-16)17-13-26-14(2)22-17/h5-6,13H,4,7-12H2,1-3H3,(H,20,21) |
| InChIKey | CGWZGJGHQAETEX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|