C16H22N4S2 — CID 119117780
1-cyclopentyl-2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine (PubChem CID 119117780) has the molecular formula C16H22N4S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 119117780 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-cyclopentyl-2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]guanidine |
| SMILES | Cc1nc(-c2ccc(CC/N=C(\N)NC3CCCC3)s2)cs1 |
| InChI | InChI=1S/C16H22N4S2/c1-11-19-14(10-21-11)15-7-6-13(22-15)8-9-18-16(17)20-12-4-2-3-5-12/h6-7,10,12H,2-5,8-9H2,1H3,(H3,17,18,20) |
| InChIKey | HGUIYWBDQMGUCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|