C17H18N4S2 — CID 110924670
2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1-phenylguanidine (PubChem CID 110924670) has the molecular formula C17H18N4S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1-phenylguanidine.
| Compound Name | 2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 110924670 |
| Molecular Formula | C17H18N4S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[2-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]ethyl]-1-phenylguanidine |
| SMILES | Cc1nc(-c2ccc(CC/N=C(\N)Nc3ccccc3)s2)cs1 |
| InChI | InChI=1S/C17H18N4S2/c1-12-20-15(11-22-12)16-8-7-14(23-16)9-10-19-17(18)21-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H3,18,19,21) |
| InChIKey | ABFQJMOAVKHENH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|