C20H23IN4OS — CID 111037221
1-(3-methoxyphenyl)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111037221) has the molecular formula C20H23IN4OS and a molecular weight of 494.40 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111037221 |
| Molecular Formula | C20H23IN4OS |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CCc2ccc(-c3csc(C)n3)cc2)c1.I |
| InChI | InChI=1S/C20H22N4OS.HI/c1-14-23-19(13-26-14)16-8-6-15(7-9-16)10-11-22-20(21)24-17-4-3-5-18(12-17)25-2;/h3-9,12-13H,10-11H2,1-2H3,(H3,21,22,24);1H |
| InChIKey | HVANGZVBDOGUEV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|