C18H23N3O — CID 111046944
1-(3-ethylphenyl)-2-[2-(3-methoxyphenyl)ethyl]guanidine (PubChem CID 111046944) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[2-(3-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[2-(3-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111046944 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[2-(3-methoxyphenyl)ethyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/CCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H23N3O/c1-3-14-6-4-8-16(12-14)21-18(19)20-11-10-15-7-5-9-17(13-15)22-2/h4-9,12-13H,3,10-11H2,1-2H3,(H3,19,20,21) |
| InChIKey | AUZLMDYCONHOBV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|