C16H17F2N3O — CID 111090273
2-[2-(3,5-difluorophenyl)ethyl]-1-(3-methoxyphenyl)guanidine (PubChem CID 111090273) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethyl]-1-(3-methoxyphenyl)guanidine.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-(3-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111090273 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-(3-methoxyphenyl)guanidine |
| SMILES | COc1cccc(N/C(N)=N/CCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C16H17F2N3O/c1-22-15-4-2-3-14(10-15)21-16(19)20-6-5-11-7-12(17)9-13(18)8-11/h2-4,7-10H,5-6H2,1H3,(H3,19,20,21) |
| InChIKey | RSMLYBDRAAUSCZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|