C22H27N5O3S2 — CID 139700352
ethyl N-[2-[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]thiophen-2-yl]ethyl]carbamate (PubChem CID 139700352) has the molecular formula C22H27N5O3S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is ethyl N-[2-[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]thiophen-2-yl]ethyl]carbamate.
| Compound Name | ethyl N-[2-[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]thiophen-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 139700352 |
| Molecular Formula | C22H27N5O3S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | ethyl N-[2-[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]thiophen-2-yl]ethyl]carbamate |
| SMILES | CCOC(=O)NCCc1ccc(-c2csc(N/C(N)=N/CCc3ccccc3OC)n2)s1 |
| InChI | InChI=1S/C22H27N5O3S2/c1-3-30-22(28)25-13-11-16-8-9-19(32-16)17-14-31-21(26-17)27-20(23)24-12-10-15-6-4-5-7-18(15)29-2/h4-9,14H,3,10-13H2,1-2H3,(H,25,28)(H3,23,24,26,27) |
| InChIKey | DNSKJFUPFXSCLB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|