C25H27N5O4S — CID 139707644
1-[4-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine (PubChem CID 139707644) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is 1-[4-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-[4-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 139707644 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-[4-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl]-1,3-thiazol-2-yl]-2-[2-(2-methoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccccc1CC/N=C(\N)Nc1nc(CCOCCN2C(=O)c3ccccc3C2=O)cs1 |
| InChI | InChI=1S/C25H27N5O4S/c1-33-21-9-5-2-6-17(21)10-12-27-24(26)29-25-28-18(16-35-25)11-14-34-15-13-30-22(31)19-7-3-4-8-20(19)23(30)32/h2-9,16H,10-15H2,1H3,(H3,26,27,28,29) |
| InChIKey | ZSWQYDPYWDYWCL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|