C22H25N5O7S — CID 67808397
N-[[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide;oxalic acid (PubChem CID 67808397) has the molecular formula C22H25N5O7S and a molecular weight of 503.54 g/mol. Its IUPAC name is N-[[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide;oxalic acid.
| Compound Name | N-[[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 67808397 |
| Molecular Formula | C22H25N5O7S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-[[5-[2-[[N'-[2-(2-methoxyphenyl)ethyl]carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide;oxalic acid |
| SMILES | COc1ccccc1CC/N=C(\N)Nc1nc(-c2ccc(CNC(C)=O)o2)cs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23N5O3S.C2H2O4/c1-13(26)23-11-15-7-8-18(28-15)16-12-29-20(24-16)25-19(21)22-10-9-14-5-3-4-6-17(14)27-2;3-1(4)2(5)6/h3-8,12H,9-11H2,1-2H3,(H,23,26)(H3,21,22,24,25);(H,3,4)(H,5,6) |
| InChIKey | QVCACYJHKNRIRJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|