C18H25N5O2S — CID 10384861
N-[[5-[2-[[N'-(cyclohexylmethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide (PubChem CID 10384861) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[[5-[2-[[N'-(cyclohexylmethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[N'-(cyclohexylmethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10384861 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[[5-[2-[[N'-(cyclohexylmethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(N/C(N)=N/CC3CCCCC3)n2)o1 |
| InChI | InChI=1S/C18H25N5O2S/c1-12(24)20-10-14-7-8-16(25-14)15-11-26-18(22-15)23-17(19)21-9-13-5-3-2-4-6-13/h7-8,11,13H,2-6,9-10H2,1H3,(H,20,24)(H3,19,21,22,23) |
| InChIKey | SRMCGDYHLYNYKR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|